CAS 256922-53-9 appears in our catalog under these names: CL075/ 99.25% (existing batch purity), CL 075, CL075 95%, 2-Propylthiazolo[4,5-c]quinolin-4-amine, 95%, 95%, CL075, 99.25%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine (CAS 256922-53-9) is a chemical compound with the molecular formula C13H13N3S and a molecular weight of 243.33 g/mol. IUPAC name: 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine. InChIKey: NFYMGJSUKCDVJR-UHFFFAOYSA-N.
| Molecular formula | C13H13N3S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 2-propyl-[1,3]thiazolo[4,5-c]quinolin-4-amine |
| InChIKey | NFYMGJSUKCDVJR-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(S1)C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)