Products 125314-13-8
CAS 125314-13-8 appears in our catalog under these names: CP21R7/ 98.21% (existing batch purity), CP21R7, CP 21, CP21R7 99%, CP21R7, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (CAS 125314-13-8) is a chemical compound with the molecular formula C19H15N3O2 and a molecular weight of 317.3 g/mol. IUPAC name: 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione. InChIKey: RGTAEYDIDMGJLX-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| InChIKey | RGTAEYDIDMGJLX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CC(=CC=C4)N |
Computed by PubChem (NCBI)