Products 179067-99-3
CAS 179067-99-3 appears in our catalog under these names: CPCCOEt/ 99.87% (existing batch purity), CPCCOEt, CPCCOEt, 98%, 98%, CPCCOEt, 98.13%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso), 50 mg.
Ethyl (7E)-7-hydroxyimino-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylate (CAS 179067-99-3) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: ethyl (7E)-7-hydroxyimino-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylate. InChIKey: FXCTZFMSAHZQTR-KAMYIIQDSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | ethyl (7E)-7-hydroxyimino-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylate |
| InChIKey | FXCTZFMSAHZQTR-KAMYIIQDSA-N |
| SMILES | CCOC(=O)C12CC1/C(=N\O)/C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)