cas: 1380006-72-3 — see every product listed under this CAS number, including other names
Carbonic acid, (1α,8α,9α)-bicyclo[6.1.0]non-4-yn-9-ylmethyl 4-nitrophenyl ester, 95%, 95% (CAS 1380006-72-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128TI-25mg |
| cas | 1380006-72-3 |
| size | 25mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 338.00 Pln | |
| Chemat | 50mg | 443.60 Pln | |
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1101.20 Pln | |
| Chemat | 1g | 2675.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate (CAS 1380006-72-3) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate. InChIKey: QXNXOXMDBLHIDB-XYPWUTKMSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl (4-nitrophenyl) carbonate |
| InChIKey | QXNXOXMDBLHIDB-XYPWUTKMSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])CCC#C1 |
Computed by PubChem (NCBI)