Products 134029-66-6
CAS 134029-66-6 is the registry number for (E)-1,2,3-Trimethoxy-5-(4-nitrostyryl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3-trimethoxy-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene (CAS 134029-66-6) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: 1,2,3-trimethoxy-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene. InChIKey: UDXWNMYENXAKPA-SNAWJCMRSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | 1,2,3-trimethoxy-5-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
| InChIKey | UDXWNMYENXAKPA-SNAWJCMRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)