CAS 21106-04-7 appears in our catalog under these names: O-Cbz-l-tyrosine, 98%, (S)-2-Amino-3-(4-(((benzyloxy)carbonyl)oxy)phenyl)propanoic acid, 97%, O–CBZ–L–TYROSINE. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g.
(2S)-2-amino-3-(4-phenylmethoxycarbonyloxyphenyl)propanoic acid (CAS 21106-04-7) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: (2S)-2-amino-3-(4-phenylmethoxycarbonyloxyphenyl)propanoic acid. InChIKey: UJTCGTXQJMMYLQ-HNNXBMFYSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-phenylmethoxycarbonyloxyphenyl)propanoic acid |
| InChIKey | UJTCGTXQJMMYLQ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)