CAS 64205-12-5 appears in our catalog under these names: Z-D-Tyr-OH, 97%, Z–D–Tyr–OH, Z-D-Tyr-OH, N-Carbobenzoxy-D-tyrosine, >98.0%(HPLC)(T), (R)-2-(((Benzyloxy)carbonyl)amino)-3-(4-hydroxyphenyl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 100 g, 500 g, 10 g.
(2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 64205-12-5) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: MCRMUCXATQAAMN-OAHLLOKOSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | (2R)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | MCRMUCXATQAAMN-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)