CAS 1421949-05-4 is the registry number for Methyl 2-(2-((3,5-dimethylisoxazol-4-yl)(hydroxy)methyl)benzofuran-5-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)-hydroxymethyl]-1-benzofuran-5-yl]acetate (CAS 1421949-05-4) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: methyl 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)-hydroxymethyl]-1-benzofuran-5-yl]acetate. InChIKey: HEHUMYPSHVTSLW-UHFFFAOYSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | methyl 2-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)-hydroxymethyl]-1-benzofuran-5-yl]acetate |
| InChIKey | HEHUMYPSHVTSLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C(C2=CC3=C(O2)C=CC(=C3)CC(=O)OC)O |
Computed by PubChem (NCBI)