CAS 2764748-88-9 appears in our catalog under these names: Carboxylesterase-IN-2, 98%, Carboxylesterase-IN-2/ 100%, Carboxylesterase–IN–2, Carboxylesterase-IN-2 98%, 6-((3,4-Dimethylphenyl)thio)-[1,2,4]triazolo[4,3-b]pyridazin-3(2H)-one, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 25 mg.
6-(3,4-dimethylphenyl)sulfanyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (CAS 2764748-88-9) is a chemical compound with the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. IUPAC name: 6-(3,4-dimethylphenyl)sulfanyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one. InChIKey: ZODAMEZBCMGEGI-UHFFFAOYSA-N.
| Molecular formula | C13H12N4OS |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 6-(3,4-dimethylphenyl)sulfanyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| InChIKey | ZODAMEZBCMGEGI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)SC2=NN3C(=NNC3=O)C=C2)C |
Computed by PubChem (NCBI)