cas: 13139-52-1 — see every product listed under this CAS number, including other names
Cbz-D-Gln-OH 98% (CAS 13139-52-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311188-250mg |
| cas | 13139-52-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 264.69 Pln | |
| Ambeed | 25g | 770.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311188 |
(2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 13139-52-1) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: JIMLDJNLXLMGLX-SNVBAGLBSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | JIMLDJNLXLMGLX-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)