cas: 4132-86-9 — see every product listed under this CAS number, including other names
Cbz-DL-Ala-OH 98% (CAS 4132-86-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144621-5g |
| cas | 4132-86-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 815.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144621 |
2-(phenylmethoxycarbonylamino)propanoic acid (CAS 4132-86-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: TYRGLVWXHJRKMT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)