cas: 35761-26-3 — see every product listed under this CAS number, including other names
Cbz-Dap-OH 97% (CAS 35761-26-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466981-1g |
| cas | 35761-26-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 882.12 Pln | |
| Ambeed | 500g | 2912.44 Pln | |
| Ambeed | 1000g | 5749.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A466981 |
(2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 35761-26-3) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: FOXRXVSTFGNURG-VIFPVBQESA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (2S)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | FOXRXVSTFGNURG-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)