CAS 62234-37-1 appears in our catalog under these names: Z–D–Dap–OH, Z-D-Dap-OH, Cbz-D-Dap-OH 97%, (R)-3-Amino-2-(((benzyloxy)carbonyl)amino)propanoic acid, 97%, 97%, (R)-3-Amino-2-(((benzyloxy)carbonyl)amino)propanoic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 100g, 500g, 50g.
(2R)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 62234-37-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: (2R)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: FOXRXVSTFGNURG-SECBINFHSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (2R)-3-amino-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | FOXRXVSTFGNURG-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)