CAS 86161-49-1 appears in our catalog under these names: L–Z–Isoleucinamide, Z–Ile–NH₂. Offered by: GLPBio. Available pack sizes: 100g, 10g, 25g, 5g.
Benzyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate (CAS 86161-49-1) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: benzyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: PDGQPWKDTCRXMR-JQWIXIFHSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | benzyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | PDGQPWKDTCRXMR-JQWIXIFHSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)