Products 128647-50-7

CAS 128647-50-7 is the registry number for N-Methyl L-Z-Valinamide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate (CAS 128647-50-7) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: benzyl N-[(2S)-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate. InChIKey: JSROABAQPZBWPX-LBPRGKRZSA-N.

Identity
Molecular formulaC14H20N2O3
Molecular weight264.32 g/mol
IUPAC namebenzyl N-[(2S)-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate
InChIKeyJSROABAQPZBWPX-LBPRGKRZSA-N
SMILESCC(C)[C@@H](C(=O)NC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)