Products 126787-11-9

CAS 126787-11-9 is the registry number for N-Phenyl 2-(BOC-amino)propanamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-anilino-1-oxopropan-2-yl)carbamate (CAS 126787-11-9) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl N-(1-anilino-1-oxopropan-2-yl)carbamate. InChIKey: OUOCJOYAOSCKKP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O3
Molecular weight264.32 g/mol
IUPAC nametert-butyl N-(1-anilino-1-oxopropan-2-yl)carbamate
InChIKeyOUOCJOYAOSCKKP-UHFFFAOYSA-N
SMILESCC(C(=O)NC1=CC=CC=C1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)