CAS 78626-99-0 is the registry number for Benzyl N-[(1S)-1-(isopropylcarbamoyl)ethyl]carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Benzyl N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate (CAS 78626-99-0) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: benzyl N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate. InChIKey: VIXPRKOAOWOKGD-NSHDSACASA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | benzyl N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]carbamate |
| InChIKey | VIXPRKOAOWOKGD-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)NC(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)