cas: 51021-87-5 — see every product listed under this CAS number, including other names
Cbz-Leu-OMe 98% (CAS 51021-87-5) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655061-25g |
| cas | 51021-87-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 253.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A655061 |
Methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate (CAS 51021-87-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate. InChIKey: TXGKPHCJHIILKF-ZDUSSCGKSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | TXGKPHCJHIILKF-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)