cas: 51021-87-5 — see every product listed under this CAS number, including other names
N-Cbz-L-leucine Methyl Ester, 95%, 95% (CAS 51021-87-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DG71-250mg |
| cas | 51021-87-5 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 184.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate (CAS 51021-87-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate. InChIKey: TXGKPHCJHIILKF-ZDUSSCGKSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | methyl (2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | TXGKPHCJHIILKF-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)