CAS 165454-06-8 appears in our catalog under these names: Cbz-NH-PEG2-CH2COOH/ 98.11% (existing batch purity), Cbz–NH–PEG2–CH2COOH, Z-NH-PEG2-CH2COOH, 3-Oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oic acid, 98%, 98%, Cbz-NH-PEG2-CH2COOH, 99.70%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 250mg, 1000mg, 2000mg, 5g, 25g.
2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid (CAS 165454-06-8) is a chemical compound with the molecular formula C14H19NO6 and a molecular weight of 297.30 g/mol. IUPAC name: 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid. InChIKey: GWUWSVXMAZFFNT-UHFFFAOYSA-N.
| Molecular formula | C14H19NO6 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid |
| InChIKey | GWUWSVXMAZFFNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)