cas: 946409-11-6 — see every product listed under this CAS number, including other names
Chroman-6-sulfonyl chloride, 95+% (CAS 946409-11-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A475878-5g |
| cas | 946409-11-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16996.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-dihydro-2H-chromene-6-sulfonyl chloride (CAS 946409-11-6) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: 3,4-dihydro-2H-chromene-6-sulfonyl chloride. InChIKey: YWWYZRQBPOAOMS-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromene-6-sulfonyl chloride |
| InChIKey | YWWYZRQBPOAOMS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)S(=O)(=O)Cl)OC1 |
Computed by PubChem (NCBI)