CAS 845790-40-1 appears in our catalog under these names: 5-(5-Chlorothiophen-2-yl)-5-oxopentanoic acid, 95+%, 5-(5-Chlorothiophen-2-yl)-5-oxopentanoic acid, 95%, 95%, 5-(5-Chloro-2-thienyl)-5-oxovaleric acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g.
5-(5-chlorothiophen-2-yl)-5-oxopentanoic acid (CAS 845790-40-1) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-5-oxopentanoic acid. InChIKey: DJQOCQPXZYBTPA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-5-oxopentanoic acid |
| InChIKey | DJQOCQPXZYBTPA-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C(=O)CCCC(=O)O |
Computed by PubChem (NCBI)