CAS 1043932-31-5 is the registry number for 2-Chloropropanoic Acid 2-Methyl-4-thioxo-4H-pyran-3-yl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
(2-methyl-4-sulfanylidenepyran-3-yl) 2-chloropropanoate (CAS 1043932-31-5) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: (2-methyl-4-sulfanylidenepyran-3-yl) 2-chloropropanoate. InChIKey: VJNCIGDFLLQJTP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | (2-methyl-4-sulfanylidenepyran-3-yl) 2-chloropropanoate |
| InChIKey | VJNCIGDFLLQJTP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=S)C=CO1)OC(=O)C(C)Cl |
Computed by PubChem (NCBI)