CAS 369638-66-4 is the registry number for 2-Methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride (CAS 369638-66-4) is a chemical compound with the molecular formula C9H9ClO3S and a molecular weight of 232.68 g/mol. IUPAC name: 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride. InChIKey: YVCGMKIEGXZBRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3S |
|---|---|
| Molecular weight | 232.68 g/mol |
| IUPAC name | 2-methyl-2,3-dihydro-1-benzofuran-5-sulfonyl chloride |
| InChIKey | YVCGMKIEGXZBRZ-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C=CC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)