Products 1782501-70-5
CAS 1782501-70-5 appears in our catalog under these names: Clobazam-13C6 (1.0mg/ml in Acetonitrile), Clobazam-13C6, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
7-chloro-5-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-methyl-1,5-benzodiazepine-2,4-dione (CAS 1782501-70-5) is a chemical compound with the molecular formula C16H13ClN2O2 and a molecular weight of 306.69 g/mol. IUPAC name: 7-chloro-5-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-methyl-1,5-benzodiazepine-2,4-dione. InChIKey: CXOXHMZGEKVPMT-FLBQOMCMSA-N.
| Molecular formula | C16H13ClN2O2 |
|---|---|
| Molecular weight | 306.69 g/mol |
| IUPAC name | 7-chloro-5-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-methyl-1,5-benzodiazepine-2,4-dione |
| InChIKey | CXOXHMZGEKVPMT-FLBQOMCMSA-N |
| SMILES | CN1C(=O)CC(=O)N(C2=C1C=CC(=C2)Cl)[13C]3=[13CH][13CH]=[13CH][13CH]=[13CH]3 |
Computed by PubChem (NCBI)