cas: 130-16-5 — see every product listed under this CAS number, including other names
Cloxiquine, 99.94% (CAS 130-16-5) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 10mM/1mL, 25 g, 500 mg, 100 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0963-50 g |
| cas | 130-16-5 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 598.33 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 25 g | 496.16 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 100 g | 742.30 Pln | |
| MedChemExpress | 5 g | 310.40 Pln | |
| MedChemExpress | 10 g | 370.78 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
5-chloroquinolin-8-ol (CAS 130-16-5) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 5-chloroquinolin-8-ol. InChIKey: CTQMJYWDVABFRZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-chloroquinolin-8-ol |
| InChIKey | CTQMJYWDVABFRZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)O)Cl |
Computed by PubChem (NCBI)