Products 952306-80-8
CAS 952306-80-8 appears in our catalog under these names: hCAII–IN–8, hCAII-IN-8, 99.41%, Compound CDy9/ 99.75% (existing batch purity), 3,4-Dimethoxy-N-(3-sulfamoylphenyl)benzamide, 98%, 98%. Offered by: GLPBio, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 25mg, 10 mg, 25 mg, 5 mg, 1mg, 5mg, 50mg.
3,4-dimethoxy-N-(3-sulfamoylphenyl)benzamide (CAS 952306-80-8) is a chemical compound with the molecular formula C15H16N2O5S and a molecular weight of 336.4 g/mol. IUPAC name: 3,4-dimethoxy-N-(3-sulfamoylphenyl)benzamide. InChIKey: NXXHQVMWOQRKGC-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 3,4-dimethoxy-N-(3-sulfamoylphenyl)benzamide |
| InChIKey | NXXHQVMWOQRKGC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)NC2=CC(=CC=C2)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)