Products 1631711-77-7
CAS 1631711-77-7 appears in our catalog under these names: Coretinphencone/ 99.95% (existing batch purity), Coretinphencone. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 1 mg, 5 mg.
1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone (CAS 1631711-77-7) is a chemical compound with the molecular formula C14H18O9 and a molecular weight of 330.29 g/mol. IUPAC name: 1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone. InChIKey: IYOWHSWFFIPSDK-LNNRFACYSA-N.
| Molecular formula | C14H18O9 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
| InChIKey | IYOWHSWFFIPSDK-LNNRFACYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Coretinphencone, orb1296876