Cyclohexane-1,3,5-tricarboxylic acid, 98%
cas: 25357-95-3 — see every product listed under this CAS number, including other names
Cyclohexane-1,3,5-tricarboxylic acid, 98% (CAS 25357-95-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A182041-250mg |
| cas | 25357-95-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1583.00 Pln | |
| Ambeed | 10g | 2628.75 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 366.80 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 1702.76 Pln | |
| BLDpharm | 10g | 2830.14 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 664.37 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: cyclohexane-1,3,5-tricarboxylic acid. InChIKey: FTHDNRBKSLBLDA-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | cyclohexane-1,3,5-tricarboxylic acid |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1alpha,3alpha,5alpha)-1,3,5-Cyclohexanetricarboxylic Acid, 1,3,5-Cyclohexanetricarboxylic acid, (1alpha,3alpha,5alpha)-, 1,3,5-Cyclohexanetricarboxylic acid, (1.alpha.,3.alpha.,5.alpha.)-, cyclohexane-1,3,5-tricarboxylic acid, Cis,cis-cyclohexane-1,3,5-tricarboxylic acid, 1,3,5-Cyclohexanetricarboxylic acid, cis,cis-1,3,5-Cyclohexanetricarboxylic acid, trans-cyclohexane-1,3,5-tricarboxylic acid, 5-Acetyl-2-thiopheneboronicacid, (1s,3s,5s)-Cyclohexane-1,3,5-tricarboxylic acid