cas: 25357-95-3 — see every product listed under this CAS number, including other names
1,3,5-Cyclohexanetricarboxylic Acid (cis- and trans- mixture), >98.0%(GC)(T) (CAS 25357-95-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2029-5G |
| cas | 25357-95-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 536.31 Pln | |
| TCI | 25g | 1677.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Cyclohexane-1,3,5-tricarboxylic acid (CAS 25357-95-3) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: cyclohexane-1,3,5-tricarboxylic acid. InChIKey: FTHDNRBKSLBLDA-UHFFFAOYSA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | cyclohexane-1,3,5-tricarboxylic acid |
| InChIKey | FTHDNRBKSLBLDA-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)