cas: 63038-64-2 — see every product listed under this CAS number, including other names
Cyclopropanamine, 2-phenyl-, (1R,2S)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1), 97%, 97% (CAS 63038-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FW86-250mg |
| cas | 63038-64-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2680.40 Pln | |
| Chemat | 25g | 5574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine (CAS 63038-64-2) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine. InChIKey: BMMYXZOHOQZKPZ-YFQRKTQFSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine |
| InChIKey | BMMYXZOHOQZKPZ-YFQRKTQFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)