Products 655-42-5
CAS 655-42-5 appears in our catalog under these names: N-Benzoyl-d-glucosamine, 98%, N–Benzoyl–D–glucosamine, N-Benzoyl-D-glucosamine, N-Benzoyl-D-glucosamine, >98.0%(N), N-Benzoyl-D-glucosamine, ≥98%(N), ≥98%(N). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 250g, 100g, 5 g.
N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)benzamide (CAS 655-42-5) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)benzamide. InChIKey: QCYHKZRHOGVACA-UHFFFAOYSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)benzamide |
| InChIKey | QCYHKZRHOGVACA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(C=O)C(C(C(CO)O)O)O |
Computed by PubChem (NCBI)