Products 1775687-16-5
CAS 1775687-16-5 is the registry number for 3-(2-(tert-Butoxy)ethoxy)-4-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-nitrobenzoic acid (CAS 1775687-16-5) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-nitrobenzoic acid. InChIKey: HUNBUJCTFPVGEG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-4-nitrobenzoic acid |
| InChIKey | HUNBUJCTFPVGEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCCOC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)