CAS 63038-64-2 appears in our catalog under these names: Cyclopropanamine, 2-phenyl-, (1r,2s)-, (2r,3r)-2,3-dihydroxybutanedioate (1:1), 97%, (1R,2S)-2-Phenylcyclopropan-1-amine (2R,3R)-2,3-dihydroxysuccinate, 98%, Cyclopropanamine, 2-phenyl-, (1R,2S)-, (2R,3R)-2,3-dihydroxybutanedioate (1:1), 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine (CAS 63038-64-2) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine. InChIKey: BMMYXZOHOQZKPZ-YFQRKTQFSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine |
| InChIKey | BMMYXZOHOQZKPZ-YFQRKTQFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)