CAS 830346-80-0 appears in our catalog under these names: Phenylephrine Impurity 31, Phenylephrine Impurity 21, Phenylephrine Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-hydroxy-4-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]-4-oxobutanoic acid (CAS 830346-80-0) is a chemical compound with the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. IUPAC name: 3-hydroxy-4-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]-4-oxobutanoic acid. InChIKey: IWWBJYCPXCCBTF-DTIOYNMSSA-N.
| Molecular formula | C13H17NO6 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 3-hydroxy-4-[[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]-4-oxobutanoic acid |
| InChIKey | IWWBJYCPXCCBTF-DTIOYNMSSA-N |
| SMILES | CN(C[C@@H](C1=CC(=CC=C1)O)O)C(=O)C(CC(=O)O)O |
Computed by PubChem (NCBI)