cas: 5785-66-0 — see every product listed under this CAS number, including other names
Cyclopropyl diphenyl carbinol, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 5785-66-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P82-100mg |
| cas | 5785-66-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 779.60 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Cyclopropyl(diphenyl)methanol (CAS 5785-66-0) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: cyclopropyl(diphenyl)methanol. InChIKey: MFKPHBJFWOOEDT-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | cyclopropyl(diphenyl)methanol |
| InChIKey | MFKPHBJFWOOEDT-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)