cas: 465500-97-4 — see every product listed under this CAS number, including other names
D-2,4-Dimethylphenylalanine (CAS 465500-97-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493598-1G |
| cas | 465500-97-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1315.18 Pln |
| delivery time | 2-3 weeks |
|---|
(2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid (CAS 465500-97-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid. InChIKey: ZEWXVRJSLTXWON-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid |
| InChIKey | ZEWXVRJSLTXWON-SNVBAGLBSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@H](C(=O)O)N)C |
Computed by PubChem (NCBI)