cas: 67877-95-6 — see every product listed under this CAS number, including other names
D-Phenylalanine, 4-nitro-, methyl ester, hydrochloride (1:1), 98%, 98% (CAS 67877-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1173PO-100mg |
| cas | 67877-95-6 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 25g | 736.40 Pln | |
| Chemat | 100g | 2296.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 67877-95-6) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-SBSPUUFOSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)