CAS 331763-78-1 appears in our catalog under these names: (R)-3-Amino-4-(4-nitro-phenyl)-butyric acid hydrochloride, 95%, (R)–3–Amino–4–(4–nitrophenyl)butanoic acid hydrochloride, (R)-3-Amino-4-(4-nitro-phenyl)-butyric acid hcl, 98%, 98%, (R)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(3R)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride (CAS 331763-78-1) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: (3R)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride. InChIKey: WPIIXVVGUXXORP-DDWIOCJRSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride |
| InChIKey | WPIIXVVGUXXORP-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)