cas: 67877-95-6 — see every product listed under this CAS number, including other names
(R)-Methyl 2-amino-3-(4-nitrophenyl)propanoate hydrochloride, 98% (CAS 67877-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F450563-250MG |
| cas | 67877-95-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 67877-95-6) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-SBSPUUFOSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)