CAS 270062-87-8 appears in our catalog under these names: (S)-3-Amino-4-(4-nitrophenyl)butanoic acid hydrochloride, 95%, (S)-3-Amino-4-(4-nitrophenyl)butanoic acid, 95%, H–β–HoPhe(4–NO2)–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 10G, 1g, 100mg.
(3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride (CAS 270062-87-8) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: (3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride. InChIKey: WPIIXVVGUXXORP-QRPNPIFTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-nitrophenyl)butanoic acid;hydrochloride |
| InChIKey | WPIIXVVGUXXORP-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)