CAS 67877-95-6 appears in our catalog under these names: H–p–Nitro–D–Phe–OMe · HCl, 4-Nitro-D-phenylalanine methyl ester hydrochloride, D-Phenylalanine, 4-nitro-, methyl ester, hydrochloride (1:1), 98%, 98%, (R)-Methyl 2-amino-3-(4-nitrophenyl)propanoate hydrochloride, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 250g, 500g, 100mg, 250mg, 1g.
Methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 67877-95-6) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-SBSPUUFOSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)