cas: 14907-27-8 — see every product listed under this CAS number, including other names
D-Tryptophan methyl ester hydrochloride, 98%, 98% (CAS 14907-27-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LDK-5g |
| cas | 14907-27-8 |
| size | 5g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 475.20 Pln | |
| Chemat | 1kg | 856.40 Pln | |
| Chemat | 1g | 74.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 14907-27-8) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-HNCPQSOCSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)