CAS 14907-27-8 appears in our catalog under these names: Tadalafil Impurity 83 HCl, Tadalafil Impurity 42, D-Tryptophan Methyl Ester Hydrochloride, H–D–Trp–OMe·HCl, H-D-Trp-OMe*HCl. Offered by: Chemat Brand, TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 5g, 25g, 1g, 5kg, 2kg, 10g, 100g.
Methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 14907-27-8) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-HNCPQSOCSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-HNCPQSOCSA-N |
| SMILES | COC(=O)[C@@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)