CAS 7524-52-9 appears in our catalog under these names: Tryptophan Impurity 4 (L-Tryptophan Methyl Ester), L-Tryptophan Methyl Ester Hydrochloride, L-Tryptophan Methyl Ester Hydrochloride, >95% (HPLC), H–Trp–OMe·HCl, H-L-Trp-OMe*HCl. Offered by: Chemat Brand, Mikromol, TRC, GLPBio, Iris Biotech. Available pack sizes: on request, 4x25mg, 25mg, 5g, 100g, 25g, 0,5kg, 0,25kg.
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 7524-52-9) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: XNFNGGQRDXFYMM-PPHPATTJSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | XNFNGGQRDXFYMM-PPHPATTJSA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)