CAS 2732985-25-8 appears in our catalog under these names: Cinoxacin-d5, D5-Cinoxacin, D5-Cinoxacin, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 1 mg, 1x10mg, 1x1ml.
4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid (CAS 2732985-25-8) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 267.25 g/mol. IUPAC name: 4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid. InChIKey: VDUWPHTZYNWKRN-ZBJDZAJPSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 4-oxo-1-(1,1,2,2,2-pentadeuterioethyl)-[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid |
| InChIKey | VDUWPHTZYNWKRN-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1C2=CC3=C(C=C2C(=O)C(=N1)C(=O)O)OCO3 |
Computed by PubChem (NCBI)