Products 160858-11-7
CAS 160858-11-7 appears in our catalog under these names: Ethofumesate-d5, Ethofumesate Ethyl-d5, >95% (HPLC), D5-Ethofumesate, D5-Ethofumesate, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards, MedChemExpress. Available pack sizes: on request, 5mg, 1x10mg, 1x1ml, 5 mg.
[3,3-dimethyl-2-(1,1,2,2,2-pentadeuterioethoxy)-2H-1-benzofuran-5-yl] methanesulfonate (CAS 160858-11-7) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 291.38 g/mol. IUPAC name: [3,3-dimethyl-2-(1,1,2,2,2-pentadeuterioethoxy)-2H-1-benzofuran-5-yl] methanesulfonate. InChIKey: IRCMYGHHKLLGHV-RPIBLTHZSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 291.38 g/mol |
| IUPAC name | [3,3-dimethyl-2-(1,1,2,2,2-pentadeuterioethoxy)-2H-1-benzofuran-5-yl] methanesulfonate |
| InChIKey | IRCMYGHHKLLGHV-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1C(C2=C(O1)C=CC(=C2)OS(=O)(=O)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Ethofumesate Ethyl-d5, EthofumesateEthyl-d5