Products 1246816-51-2
CAS 1246816-51-2 appears in our catalog under these names: Metazachlor-d6, >95% (HPLC), Metazachlor-d6, 99.35%, D6-Metazachlor, ISO 17034 RM, D6-Metazachlor, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 1 mg, 5mg, 1ml.
N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(pyrazol-1-ylmethyl)acetamide (CAS 1246816-51-2) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 283.78 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(pyrazol-1-ylmethyl)acetamide. InChIKey: STEPQTYSZVCJPV-WFGJKAKNSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 283.78 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(pyrazol-1-ylmethyl)acetamide |
| InChIKey | STEPQTYSZVCJPV-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])N(CN2C=CC=N2)C(=O)CCl |
Computed by PubChem (NCBI)
Synonyms:
Metazachlor-d6