cas: 1431-39-6 — see every product listed under this CAS number, including other names
DANSYLAMIDE, 98% (CAS 1431-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F866163-100MG |
| cas | 1431-39-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2018.06 Pln | |
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1527.38 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5-(dimethylamino)naphthalene-1-sulfonamide (CAS 1431-39-6) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 5-(dimethylamino)naphthalene-1-sulfonamide. InChIKey: TYNBFJJKZPTRKS-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 5-(dimethylamino)naphthalene-1-sulfonamide |
| InChIKey | TYNBFJJKZPTRKS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)