CAS 1431-39-6 appears in our catalog under these names: 5-Dimethylamino-1-naphthalenesulfonamide, 98%, Dansylamide/ 98.72% (existing batch purity), Dansylamide, 5-(Dimethylamino)-1-naphthalenesulfonamide, Dansylamide [for Albumin binding assay], >98.0%(T). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 250mg, 1g, 200mg, 100mg, 10mM (in 1ml dmso), 2,5g, 25mg.
5-(dimethylamino)naphthalene-1-sulfonamide (CAS 1431-39-6) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: 5-(dimethylamino)naphthalene-1-sulfonamide. InChIKey: TYNBFJJKZPTRKS-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2S |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | 5-(dimethylamino)naphthalene-1-sulfonamide |
| InChIKey | TYNBFJJKZPTRKS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)